About 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine
4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine (PubChem CID 174194419) has the molecular formula C11H18FN3
and a molecular weight of 211.28 g/mol. Its IUPAC name is 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine |
| PubChem CID | 174194419 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine |
| SMILES | CC1CN(C2=CCNC=C2F)CCN1C |
| InChI | InChI=1S/C11H18FN3/c1-9-8-15(6-5-14(9)2)11-3-4-13-7-10(11)12/h3,7,9,13H,4-6,8H2,1-2H3 |
| InChIKey | CYQYMWRXIYTALL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine?
The IUPAC name of 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine (CID 174194419) is 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine.
What is the SMILES notation for 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine?
The canonical SMILES for 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine is CC1CN(C2=CCNC=C2F)CCN1C.
What is the InChIKey of 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine?
The InChIKey is CYQYMWRXIYTALL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FN3/c1-9-8-15(6-5-14(9)2)11-3-4-13-7-10(11)12/h3,7,9,13H,4-6,8H2,1-2H3.
What are the key properties of 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine?
4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine has a molecular weight of 211.28 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-1,2-dihydropyridin-4-yl)-1,2-dimethylpiperazine is sourced from PubChem (CID 174194419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).