About N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine
N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine (PubChem CID 174194529) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine |
| PubChem CID | 174194529 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine |
| SMILES | CC(C)COC1/C=C\CCCC=C1CCN(C)C |
| InChI | InChI=1S/C16H29NO/c1-14(2)13-18-16-10-8-6-5-7-9-15(16)11-12-17(3)4/h8-10,14,16H,5-7,11-13H2,1-4H3/b10-8-,15-9? |
| InChIKey | RUFKVMURJQKQJG-CHHWORCESA-N |
| XLogP | 3.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine?
The IUPAC name of N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine (CID 174194529) is N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine.
What is the SMILES notation for N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine?
The canonical SMILES for N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine is CC(C)COC1/C=C\CCCC=C1CCN(C)C.
What is the InChIKey of N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine?
The InChIKey is RUFKVMURJQKQJG-CHHWORCESA-N. The full InChI is InChI=1S/C16H29NO/c1-14(2)13-18-16-10-8-6-5-7-9-15(16)11-12-17(3)4/h8-10,14,16H,5-7,11-13H2,1-4H3/b10-8-,15-9?.
What are the key properties of N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine?
N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine has a molecular weight of 251.41 g/mol, XLogP of 3.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-[(6E)-8-(2-methylpropoxy)cycloocta-1,6-dien-1-yl]ethanamine is sourced from PubChem (CID 174194529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).