C13H22FN3 — CID 174194532
N'-[4-(fluoromethyl)-2,7-dihydroazocin-5-yl]-N,N'-dimethylpropane-1,3-diamine (PubChem CID 174194532) has the molecular formula C13H22FN3 and a molecular weight of 239.34 g/mol. Its IUPAC name is N'-[4-(fluoromethyl)-2,7-dihydroazocin-5-yl]-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-[4-(fluoromethyl)-2,7-dihydroazocin-5-yl]-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 174194532 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | N'-[4-(fluoromethyl)-2,7-dihydroazocin-5-yl]-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)C1=CC/C=N\CC=C1CF |
| InChI | InChI=1S/C13H22FN3/c1-15-7-4-10-17(2)13-5-3-8-16-9-6-12(13)11-14/h5-6,8,15H,3-4,7,9-11H2,1-2H3/b12-6?,13-5?,16-8- |
| InChIKey | SRMQVNGORAMMKK-VOENNIRSSA-N |
| XLogP | 1.78 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|