C16H11BrF2N6 — CID 174194972
8-(3-bromo-2,6-difluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene (PubChem CID 174194972) has the molecular formula C16H11BrF2N6 and a molecular weight of 405.21 g/mol. Its IUPAC name is 8-(3-bromo-2,6-difluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene.
| Compound Name | 8-(3-bromo-2,6-difluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene |
|---|---|
| PubChem CID | 174194972 |
| Molecular Formula | C16H11BrF2N6 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 8-(3-bromo-2,6-difluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene |
| SMILES | Cc1[nH]nc2c1N=C(c1c(F)ccc(Br)c1F)N1CCn3ncc-2c31 |
| InChI | InChI=1S/C16H11BrF2N6/c1-7-13-14(23-22-7)8-6-20-25-5-4-24(16(8)25)15(21-13)11-10(18)3-2-9(17)12(11)19/h2-3,6H,4-5H2,1H3,(H,22,23) |
| InChIKey | KBKNFQUOVYGQBA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|