About 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline
5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline (PubChem CID 174194995) has the molecular formula C15H16F3N3
and a molecular weight of 295.31 g/mol. Its IUPAC name is 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline.
Molecular Properties
| Compound Name | 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline |
| PubChem CID | 174194995 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline |
| SMILES | CC(C)c1cccc2c1N(C)Cc1cc(C(F)(F)F)nn1-2 |
| InChI | InChI=1S/C15H16F3N3/c1-9(2)11-5-4-6-12-14(11)20(3)8-10-7-13(15(16,17)18)19-21(10)12/h4-7,9H,8H2,1-3H3 |
| InChIKey | RTHSLOLQDNAMNH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline?
The IUPAC name of 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline (CID 174194995) is 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline.
What is the SMILES notation for 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline?
The canonical SMILES for 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline is CC(C)c1cccc2c1N(C)Cc1cc(C(F)(F)F)nn1-2.
What is the InChIKey of 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline?
The InChIKey is RTHSLOLQDNAMNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3N3/c1-9(2)11-5-4-6-12-14(11)20(3)8-10-7-13(15(16,17)18)19-21(10)12/h4-7,9H,8H2,1-3H3.
What are the key properties of 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline?
5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline has a molecular weight of 295.31 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-propan-2-yl-2-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinoxaline is sourced from PubChem (CID 174194995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).