C12H22FN — CID 174195010
(2E,4E)-4-fluoro-N,N-dipropylhexa-2,4-dien-3-amine (PubChem CID 174195010) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is (2E,4E)-4-fluoro-N,N-dipropylhexa-2,4-dien-3-amine.
| Compound Name | (2E,4E)-4-fluoro-N,N-dipropylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 174195010 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (2E,4E)-4-fluoro-N,N-dipropylhexa-2,4-dien-3-amine |
| SMILES | C/C=C(F)\C(=C/C)N(CCC)CCC |
| InChI | InChI=1S/C12H22FN/c1-5-9-14(10-6-2)12(8-4)11(13)7-3/h7-8H,5-6,9-10H2,1-4H3/b11-7+,12-8+ |
| InChIKey | ZQSMFWNCMGXBBV-MKICQXMISA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|