C12H21NO4 — CID 174195480
4-(hydroxymethyl)-N-[(2R)-1-hydroxy-3-oxobutan-2-yl]cyclohexane-1-carboxamide (PubChem CID 174195480) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[(2R)-1-hydroxy-3-oxobutan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(hydroxymethyl)-N-[(2R)-1-hydroxy-3-oxobutan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 174195480 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 4-(hydroxymethyl)-N-[(2R)-1-hydroxy-3-oxobutan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)[C@@H](CO)NC(=O)C1CCC(CO)CC1 |
| InChI | InChI=1S/C12H21NO4/c1-8(16)11(7-15)13-12(17)10-4-2-9(6-14)3-5-10/h9-11,14-15H,2-7H2,1H3,(H,13,17)/t9?,10?,11-/m1/s1 |
| InChIKey | IPJFVFSCIPTNEZ-VQXHTEKXSA-N |
| XLogP | -0.15 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |