About 2,3,4-trimethylpyrido[2,3-d]pyridazine
2,3,4-trimethylpyrido[2,3-d]pyridazine (PubChem CID 174195807) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 2,3,4-trimethylpyrido[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 2,3,4-trimethylpyrido[2,3-d]pyridazine |
| PubChem CID | 174195807 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2,3,4-trimethylpyrido[2,3-d]pyridazine |
| SMILES | Cc1nc2cnncc2c(C)c1C |
| InChI | InChI=1S/C10H11N3/c1-6-7(2)9-4-11-12-5-10(9)13-8(6)3/h4-5H,1-3H3 |
| InChIKey | IHQLWDTYIHWOGY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3,4-trimethylpyrido[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethylpyrido[2,3-d]pyridazine?
The IUPAC name of 2,3,4-trimethylpyrido[2,3-d]pyridazine (CID 174195807) is 2,3,4-trimethylpyrido[2,3-d]pyridazine.
What is the SMILES notation for 2,3,4-trimethylpyrido[2,3-d]pyridazine?
The canonical SMILES for 2,3,4-trimethylpyrido[2,3-d]pyridazine is Cc1nc2cnncc2c(C)c1C.
What is the InChIKey of 2,3,4-trimethylpyrido[2,3-d]pyridazine?
The InChIKey is IHQLWDTYIHWOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-6-7(2)9-4-11-12-5-10(9)13-8(6)3/h4-5H,1-3H3.
What are the key properties of 2,3,4-trimethylpyrido[2,3-d]pyridazine?
2,3,4-trimethylpyrido[2,3-d]pyridazine has a molecular weight of 173.22 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethylpyrido[2,3-d]pyridazine is sourced from PubChem (CID 174195807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).