C26H49N — CID 174195822
N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethyl-N-(2,4,4-trimethylhex-5-en-2-yl)hex-5-en-2-amine (PubChem CID 174195822) has the molecular formula C26H49N and a molecular weight of 375.69 g/mol. Its IUPAC name is N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethyl-N-(2,4,4-trimethylhex-5-en-2-yl)hex-5-en-2-amine.
| Compound Name | N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethyl-N-(2,4,4-trimethylhex-5-en-2-yl)hex-5-en-2-amine |
|---|---|
| PubChem CID | 174195822 |
| Molecular Formula | C26H49N |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 375.39 |
| IUPAC Name | N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethyl-N-(2,4,4-trimethylhex-5-en-2-yl)hex-5-en-2-amine |
| SMILES | C=CC(C)(C)CC(C)N(C(C)(C)CC(C)(C)C=C)C(C)(C)CC(C)(C)C=C |
| InChI | InChI=1S/C26H49N/c1-15-22(5,6)18-21(4)27(25(11,12)19-23(7,8)16-2)26(13,14)20-24(9,10)17-3/h15-17,21H,1-3,18-20H2,4-14H3 |
| InChIKey | ZZIIEYLVMRTIGP-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|