C18H21F8N5O2S — CID 174195895
2,2-dimethyl-N'-[(Z)-3-[3-[(3E,5E)-6-(pentafluoro-λ6-sulfanyl)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide (PubChem CID 174195895) has the molecular formula C18H21F8N5O2S and a molecular weight of 523.45 g/mol. Its IUPAC name is 2,2-dimethyl-N'-[(Z)-3-[3-[(3E,5E)-6-(pentafluoro-λ6-sulfanyl)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide.
| Compound Name | 2,2-dimethyl-N'-[(Z)-3-[3-[(3E,5E)-6-(pentafluoro-λ6-sulfanyl)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 174195895 |
| Molecular Formula | C18H21F8N5O2S |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 2,2-dimethyl-N'-[(Z)-3-[3-[(3E,5E)-6-(pentafluoro-λ6-sulfanyl)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
| SMILES | C=C(/C=C(\C=C(/C)S(F)(F)(F)(F)F)C(F)(F)F)c1ncn(/C=C\C(=O)NNC(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C18H21F8N5O2S/c1-11(8-13(18(19,20)21)9-12(2)34(22,23,24,25)26)15-27-10-31(30-15)7-6-14(32)28-29-16(33)17(3,4)5/h6-10H,1H2,2-5H3,(H,28,32)(H,29,33)/b7-6-,12-9+,13-8+ |
| InChIKey | HGTSSPVLEDPKFS-OEKXCRGNSA-N |
| XLogP | 5.65 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|