C24H31FN2OS — CID 174195966
(13S,15R)-15-[3-(4,5-dihydro-1,3-thiazol-2-ylamino)propyl]-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 174195966) has the molecular formula C24H31FN2OS and a molecular weight of 414.59 g/mol. Its IUPAC name is (13S,15R)-15-[3-(4,5-dihydro-1,3-thiazol-2-ylamino)propyl]-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (13S,15R)-15-[3-(4,5-dihydro-1,3-thiazol-2-ylamino)propyl]-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 174195966 |
| Molecular Formula | C24H31FN2OS |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (13S,15R)-15-[3-(4,5-dihydro-1,3-thiazol-2-ylamino)propyl]-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC3c4cccc(F)c4CCC3C1C(CCCNC1=NCCS1)CC2=O |
| InChI | InChI=1S/C24H31FN2OS/c1-24-10-9-17-16-5-2-6-20(25)18(16)7-8-19(17)22(24)15(14-21(24)28)4-3-11-26-23-27-12-13-29-23/h2,5-6,15,17,19,22H,3-4,7-14H2,1H3,(H,26,27)/t15?,17?,19?,22?,24-/m1/s1 |
| InChIKey | FDHPSHRPVLAGQF-WURIDXQFSA-N |
| XLogP | 4.95 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|