About 7,8-diiodopyrido[4,3-c]pyridazine
7,8-diiodopyrido[4,3-c]pyridazine (PubChem CID 174195987) has the molecular formula C7H3I2N3
and a molecular weight of 382.93 g/mol. Its IUPAC name is 7,8-diiodopyrido[4,3-c]pyridazine.
Molecular Properties
| Compound Name | 7,8-diiodopyrido[4,3-c]pyridazine |
| PubChem CID | 174195987 |
| Molecular Formula | C7H3I2N3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.84 |
| IUPAC Name | 7,8-diiodopyrido[4,3-c]pyridazine |
| SMILES | Ic1ncc2ccnnc2c1I |
| InChI | InChI=1S/C7H3I2N3/c8-5-6-4(1-2-11-12-6)3-10-7(5)9/h1-3H |
| InChIKey | VPNGAXUDYHWIDZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7,8-diiodopyrido[4,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diiodopyrido[4,3-c]pyridazine?
The IUPAC name of 7,8-diiodopyrido[4,3-c]pyridazine (CID 174195987) is 7,8-diiodopyrido[4,3-c]pyridazine.
What is the SMILES notation for 7,8-diiodopyrido[4,3-c]pyridazine?
The canonical SMILES for 7,8-diiodopyrido[4,3-c]pyridazine is Ic1ncc2ccnnc2c1I.
What is the InChIKey of 7,8-diiodopyrido[4,3-c]pyridazine?
The InChIKey is VPNGAXUDYHWIDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3I2N3/c8-5-6-4(1-2-11-12-6)3-10-7(5)9/h1-3H.
What are the key properties of 7,8-diiodopyrido[4,3-c]pyridazine?
7,8-diiodopyrido[4,3-c]pyridazine has a molecular weight of 382.93 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diiodopyrido[4,3-c]pyridazine is sourced from PubChem (CID 174195987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).