C9H13N2+ — CID 174195990
1-methyl-6-propan-2-yl-4-aza-1-azoniacyclohepta-1,2,4,6-tetraene (PubChem CID 174195990) has the molecular formula C9H13N2+ and a molecular weight of 149.22 g/mol. Its IUPAC name is 1-methyl-6-propan-2-yl-4-aza-1-azoniacyclohepta-1,2,4,6-tetraene.
| Compound Name | 1-methyl-6-propan-2-yl-4-aza-1-azoniacyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 174195990 |
| Molecular Formula | C9H13N2+ |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | 1-methyl-6-propan-2-yl-4-aza-1-azoniacyclohepta-1,2,4,6-tetraene |
| SMILES | CC(C)C1=C[N+](C)=C=CN=C1 |
| InChI | InChI=1S/C9H13N2/c1-8(2)9-6-10-4-5-11(3)7-9/h4,6-8H,1-3H3/q+1 |
| InChIKey | SFRBQBXXSPCSQA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|