C8H14NP — CID 174196362
3,3a,6,6a-tetrahydro-1H-cyclopenta[c]phosphol-2-ylmethanamine (PubChem CID 174196362) has the molecular formula C8H14NP and a molecular weight of 155.18 g/mol. Its IUPAC name is 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]phosphol-2-ylmethanamine.
| Compound Name | 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]phosphol-2-ylmethanamine |
|---|---|
| PubChem CID | 174196362 |
| Molecular Formula | C8H14NP |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]phosphol-2-ylmethanamine |
| SMILES | NCP1CC2C=CCC2C1 |
| InChI | InChI=1S/C8H14NP/c9-6-10-4-7-2-1-3-8(7)5-10/h1-2,7-8H,3-6,9H2 |
| InChIKey | WJWSRPGMNFONCI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|