C17H25NO6 — CID 174196641
(2R)-3-[4-(methoxymethoxy)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 174196641) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2R)-3-[4-(methoxymethoxy)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R)-3-[4-(methoxymethoxy)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 174196641 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R)-3-[4-(methoxymethoxy)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | COCOc1ccc(C[C@@H](NC(=O)OC(C)(C)C)C(=O)O)cc1C |
| InChI | InChI=1S/C17H25NO6/c1-11-8-12(6-7-14(11)23-10-22-5)9-13(15(19)20)18-16(21)24-17(2,3)4/h6-8,13H,9-10H2,1-5H3,(H,18,21)(H,19,20)/t13-/m1/s1 |
| InChIKey | KBPDRUWGKPOKDT-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|