C30H28F2N6O3S2 — CID 174197302
N-[2-[(2S,4R)-4-(difluoromethylamino)-2-[N'-[(1R)-1-thieno[3,2-c]pyridin-2-ylethyl]carbamimidoyl]pyrrolidin-1-yl]-2-oxoethyl]phenoxathiine-3-carboxamide (PubChem CID 174197302) has the molecular formula C30H28F2N6O3S2 and a molecular weight of 622.72 g/mol. Its IUPAC name is N-[2-[(2S,4R)-4-(difluoromethylamino)-2-[N'-[(1R)-1-thieno[3,2-c]pyridin-2-ylethyl]carbamimidoyl]pyrrolidin-1-yl]-2-oxoethyl]phenoxathiine-3-carboxamide.
| Compound Name | N-[2-[(2S,4R)-4-(difluoromethylamino)-2-[N'-[(1R)-1-thieno[3,2-c]pyridin-2-ylethyl]carbamimidoyl]pyrrolidin-1-yl]-2-oxoethyl]phenoxathiine-3-carboxamide |
|---|---|
| PubChem CID | 174197302 |
| Molecular Formula | C30H28F2N6O3S2 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | N-[2-[(2S,4R)-4-(difluoromethylamino)-2-[N'-[(1R)-1-thieno[3,2-c]pyridin-2-ylethyl]carbamimidoyl]pyrrolidin-1-yl]-2-oxoethyl]phenoxathiine-3-carboxamide |
| SMILES | C[C@@H](/N=C(\N)[C@@H]1C[C@@H](NC(F)F)CN1C(=O)CNC(=O)c1ccc2c(c1)Oc1ccccc1S2)c1cc2cnccc2s1 |
| InChI | InChI=1S/C30H28F2N6O3S2/c1-16(26-11-18-13-34-9-8-23(18)42-26)36-28(33)20-12-19(37-30(31)32)15-38(20)27(39)14-35-29(40)17-6-7-25-22(10-17)41-21-4-2-3-5-24(21)43-25/h2-11,13,16,19-20,30,37H,12,14-15H2,1H3,(H2,33,36)(H,35,40)/t16-,19-,20+/m1/s1 |
| InChIKey | BZIAAUQBPZJYAC-AHRSYUTCSA-N |
| XLogP | 5.18 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|