C31H32N4O4S2 — CID 174197447
(1S,3S,5S)-5-methyl-2-[2-(phenoxathiine-3-carbonylamino)acetyl]-N-[(1R)-1-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 174197447) has the molecular formula C31H32N4O4S2 and a molecular weight of 588.76 g/mol. Its IUPAC name is (1S,3S,5S)-5-methyl-2-[2-(phenoxathiine-3-carbonylamino)acetyl]-N-[(1R)-1-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1S,3S,5S)-5-methyl-2-[2-(phenoxathiine-3-carbonylamino)acetyl]-N-[(1R)-1-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 174197447 |
| Molecular Formula | C31H32N4O4S2 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | (1S,3S,5S)-5-methyl-2-[2-(phenoxathiine-3-carbonylamino)acetyl]-N-[(1R)-1-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@H]1C[C@]2(C)C[C@@H]2N1C(=O)CNC(=O)c1ccc2c(c1)Oc1ccccc1S2)c1cc2c(s1)CNCC2 |
| InChI | InChI=1S/C31H32N4O4S2/c1-17(25-12-18-9-10-32-15-26(18)41-25)34-30(38)20-13-31(2)14-27(31)35(20)28(36)16-33-29(37)19-7-8-24-22(11-19)39-21-5-3-4-6-23(21)40-24/h3-8,11-12,17,20,27,32H,9-10,13-16H2,1-2H3,(H,33,37)(H,34,38)/t17-,20+,27+,31-/m1/s1 |
| InChIKey | IPYUTOWDJZIMRJ-MJUXVWRCSA-N |
| XLogP | 4.64 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |