C32H39F3N3O5P — CID 174198235
10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium;2,2,2-trifluoroacetate (PubChem CID 174198235) has the molecular formula C32H39F3N3O5P and a molecular weight of 633.65 g/mol. Its IUPAC name is 10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | 10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174198235 |
| Molecular Formula | C32H39F3N3O5P |
| Molecular Weight | 633.65 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | 10-(hydroxycarbamoylcarbamoylamino)decyl-triphenylphosphanium;2,2,2-trifluoroacetate |
| SMILES | O=C(NO)NC(=O)NCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H38N3O3P.C2HF3O2/c34-29(32-30(35)33-36)31-24-16-5-3-1-2-4-6-17-25-37(26-18-10-7-11-19-26,27-20-12-8-13-21-27)28-22-14-9-15-23-28;3-2(4,5)1(6)7/h7-15,18-23H,1-6,16-17,24-25H2,(H3-,31,32,33,34,35,36);(H,6,7) |
| InChIKey | ULXVFJSZLOYMKK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|