C18H8F2N4 — CID 174199124
2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-(4,5-difluoro-3-pyridinyl)acetonitrile (PubChem CID 174199124) has the molecular formula C18H8F2N4 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-(4,5-difluoro-3-pyridinyl)acetonitrile.
| Compound Name | 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-(4,5-difluoro-3-pyridinyl)acetonitrile |
|---|---|
| PubChem CID | 174199124 |
| Molecular Formula | C18H8F2N4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-(4,5-difluoro-3-pyridinyl)acetonitrile |
| SMILES | N#CC(=C1c2cccnc2-c2ncccc21)c1cncc(F)c1F |
| InChI | InChI=1S/C18H8F2N4/c19-14-9-22-8-13(16(14)20)12(7-21)15-10-3-1-5-23-17(10)18-11(15)4-2-6-24-18/h1-6,8-9H |
| InChIKey | ACZWZAZSDUEBBI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|