C15H29N — CID 174199616
2-tert-butyl-5-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 174199616) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 2-tert-butyl-5-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 2-tert-butyl-5-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 174199616 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2-tert-butyl-5-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CC(C)C1CCC2CN(C(C)(C)C)CC2C1 |
| InChI | InChI=1S/C15H29N/c1-11(2)12-6-7-13-9-16(15(3,4)5)10-14(13)8-12/h11-14H,6-10H2,1-5H3 |
| InChIKey | DZEZJJBXEUISFY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |