C32H43N3O — CID 174199903
4-[7-[2-[1-[3-(6-ethyl-3-pyridinyl)prop-1-en-2-yl]piperidin-2-yl]ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]hex-5-enal (PubChem CID 174199903) has the molecular formula C32H43N3O and a molecular weight of 485.72 g/mol. Its IUPAC name is 4-[7-[2-[1-[3-(6-ethyl-3-pyridinyl)prop-1-en-2-yl]piperidin-2-yl]ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]hex-5-enal.
| Compound Name | 4-[7-[2-[1-[3-(6-ethyl-3-pyridinyl)prop-1-en-2-yl]piperidin-2-yl]ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]hex-5-enal |
|---|---|
| PubChem CID | 174199903 |
| Molecular Formula | C32H43N3O |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | 4-[7-[2-[1-[3-(6-ethyl-3-pyridinyl)prop-1-en-2-yl]piperidin-2-yl]ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]hex-5-enal |
| SMILES | C=CC(CCC=O)N1CCc2ccc(CCC3CCCCN3C(=C)Cc3ccc(CC)nc3)cc2C1 |
| InChI | InChI=1S/C32H43N3O/c1-4-30-15-12-27(23-33-30)21-25(3)35-18-7-6-9-32(35)16-13-26-11-14-28-17-19-34(24-29(28)22-26)31(5-2)10-8-20-36/h5,11-12,14-15,20,22-23,31-32H,2-4,6-10,13,16-19,21,24H2,1H3 |
| InChIKey | XOMQAZKCTKPYLI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|