About 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride
4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride (PubChem CID 174200056) has the molecular formula C8H17ClN4
and a molecular weight of 204.71 g/mol. Its IUPAC name is 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride |
| PubChem CID | 174200056 |
| Molecular Formula | C8H17ClN4 |
| Molecular Weight | 204.71 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride |
| SMILES | CC(C)CC(N)Cn1cncn1.Cl |
| InChI | InChI=1S/C8H16N4.ClH/c1-7(2)3-8(9)4-12-6-10-5-11-12;/h5-8H,3-4,9H2,1-2H3;1H |
| InChIKey | MARPSILXBCDFJB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.71 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride?
The IUPAC name of 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride (CID 174200056) is 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride.
What is the SMILES notation for 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride?
The canonical SMILES for 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride is CC(C)CC(N)Cn1cncn1.Cl.
What is the InChIKey of 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride?
The InChIKey is MARPSILXBCDFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4.ClH/c1-7(2)3-8(9)4-12-6-10-5-11-12;/h5-8H,3-4,9H2,1-2H3;1H.
What are the key properties of 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride?
4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride has a molecular weight of 204.71 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine;hydrochloride is sourced from PubChem (CID 174200056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).