C19H17ClF4N6O2 — CID 174200244
(Z,4Z)-3-[2-amino-4-[4-fluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-chloro-4-(methylhydrazinylidene)but-2-enal (PubChem CID 174200244) has the molecular formula C19H17ClF4N6O2 and a molecular weight of 472.83 g/mol. Its IUPAC name is (Z,4Z)-3-[2-amino-4-[4-fluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-chloro-4-(methylhydrazinylidene)but-2-enal.
| Compound Name | (Z,4Z)-3-[2-amino-4-[4-fluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-chloro-4-(methylhydrazinylidene)but-2-enal |
|---|---|
| PubChem CID | 174200244 |
| Molecular Formula | C19H17ClF4N6O2 |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (Z,4Z)-3-[2-amino-4-[4-fluoro-2-(trifluoromethyl)phenoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-chloro-4-(methylhydrazinylidene)but-2-enal |
| SMILES | CN/N=C\C(=C(\Cl)C=O)N1CCc2c(nc(N)nc2Oc2ccc(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C19H17ClF4N6O2/c1-26-27-7-15(13(20)9-31)30-5-4-11-14(8-30)28-18(25)29-17(11)32-16-3-2-10(21)6-12(16)19(22,23)24/h2-3,6-7,9,26H,4-5,8H2,1H3,(H2,25,28,29)/b15-13-,27-7- |
| InChIKey | YWSBAGUQIGNWDS-YNQFDZHVSA-N |
| XLogP | 3.22 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|