C14H18FN3O2 — CID 174200246
3-[2-[(3S,4R)-4-fluorooxolan-3-yl]-1,5-dihydropyrazol-4-yl]-2-methoxyaniline (PubChem CID 174200246) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 3-[2-[(3S,4R)-4-fluorooxolan-3-yl]-1,5-dihydropyrazol-4-yl]-2-methoxyaniline.
| Compound Name | 3-[2-[(3S,4R)-4-fluorooxolan-3-yl]-1,5-dihydropyrazol-4-yl]-2-methoxyaniline |
|---|---|
| PubChem CID | 174200246 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-[2-[(3S,4R)-4-fluorooxolan-3-yl]-1,5-dihydropyrazol-4-yl]-2-methoxyaniline |
| SMILES | COc1c(N)cccc1C1=CN([C@H]2COC[C@@H]2F)NC1 |
| InChI | InChI=1S/C14H18FN3O2/c1-19-14-10(3-2-4-12(14)16)9-5-17-18(6-9)13-8-20-7-11(13)15/h2-4,6,11,13,17H,5,7-8,16H2,1H3/t11-,13-/m0/s1 |
| InChIKey | FJOBXNPUAASLID-AAEUAGOBSA-N |
| XLogP | 1.18 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|