About 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline
3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline (PubChem CID 174200339) has the molecular formula C15H22FN3O2
and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline.
Molecular Properties
| Compound Name | 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline |
| PubChem CID | 174200339 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline |
| SMILES | CC[C@]1(N(N)/C=C/c2cccc(N)c2OC)COC[C@@H]1F |
| InChI | InChI=1S/C15H22FN3O2/c1-3-15(10-21-9-13(15)16)19(18)8-7-11-5-4-6-12(17)14(11)20-2/h4-8,13H,3,9-10,17-18H2,1-2H3/b8-7+/t13-,15-/m0/s1 |
| InChIKey | OQCLVULEXAPHDT-IZYAJXRASA-N |
| XLogP | 1.94 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline?
The IUPAC name of 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline (CID 174200339) is 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline.
What is the SMILES notation for 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline?
The canonical SMILES for 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline is CC[C@]1(N(N)/C=C/c2cccc(N)c2OC)COC[C@@H]1F.
What is the InChIKey of 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline?
The InChIKey is OQCLVULEXAPHDT-IZYAJXRASA-N. The full InChI is InChI=1S/C15H22FN3O2/c1-3-15(10-21-9-13(15)16)19(18)8-7-11-5-4-6-12(17)14(11)20-2/h4-8,13H,3,9-10,17-18H2,1-2H3/b8-7+/t13-,15-/m0/s1.
What are the key properties of 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline?
3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline has a molecular weight of 295.36 g/mol, XLogP of 1.94, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-[amino-[(3S,4R)-3-ethyl-4-fluorooxolan-3-yl]amino]ethenyl]-2-methoxyaniline is sourced from PubChem (CID 174200339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).