About 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one
8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one (PubChem CID 174203302) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one.
Molecular Properties
| Compound Name | 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one |
| PubChem CID | 174203302 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one |
| SMILES | Cc1cc(C(C)N)c2oc(-c3ccnn3C)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C17H19N3O2/c1-9-7-12(11(3)18)17-13(8-9)15(21)10(2)16(22-17)14-5-6-19-20(14)4/h5-8,11H,18H2,1-4H3 |
| InChIKey | FZZPNSRORVYZDA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one?
The IUPAC name of 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one (CID 174203302) is 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one.
What is the SMILES notation for 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one?
The canonical SMILES for 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one is Cc1cc(C(C)N)c2oc(-c3ccnn3C)c(C)c(=O)c2c1.
What is the InChIKey of 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one?
The InChIKey is FZZPNSRORVYZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2/c1-9-7-12(11(3)18)17-13(8-9)15(21)10(2)16(22-17)14-5-6-19-20(14)4/h5-8,11H,18H2,1-4H3.
What are the key properties of 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one?
8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one has a molecular weight of 297.36 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-aminoethyl)-3,6-dimethyl-2-(2-methylpyrazol-3-yl)chromen-4-one is sourced from PubChem (CID 174203302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).