C15H13N3O4S2 — CID 17420361
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 17420361) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 17420361 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=C(CN1CCSC1=O)Nc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C15H13N3O4S2/c19-13(6-18-3-4-23-15(18)20)17-14-16-10(7-24-14)9-1-2-11-12(5-9)22-8-21-11/h1-2,5,7H,3-4,6,8H2,(H,16,17,19) |
| InChIKey | SACRFXTWKIFEDY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|