About (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine
(3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine (PubChem CID 174203857) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine.
Molecular Properties
| Compound Name | (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine |
| PubChem CID | 174203857 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine |
| SMILES | C=C(CC)/C(=C1/C=CN(C)/C1=N\C)C(C)C |
| InChI | InChI=1S/C14H22N2/c1-7-11(4)13(10(2)3)12-8-9-16(6)14(12)15-5/h8-10H,4,7H2,1-3,5-6H3/b13-12-,15-14- |
| InChIKey | XRWOKTLKMAVWNO-ZJQKOVPWSA-N |
| XLogP | 3.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine?
The IUPAC name of (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine (CID 174203857) is (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine.
What is the SMILES notation for (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine?
The canonical SMILES for (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine is C=C(CC)/C(=C1/C=CN(C)/C1=N\C)C(C)C.
What is the InChIKey of (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine?
The InChIKey is XRWOKTLKMAVWNO-ZJQKOVPWSA-N. The full InChI is InChI=1S/C14H22N2/c1-7-11(4)13(10(2)3)12-8-9-16(6)14(12)15-5/h8-10H,4,7H2,1-3,5-6H3/b13-12-,15-14-.
What are the key properties of (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine?
(3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine has a molecular weight of 218.34 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N,1-dimethyl-3-(2-methyl-4-methylidenehexan-3-ylidene)pyrrol-2-imine is sourced from PubChem (CID 174203857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).