C17H23BFNO5 — CID 174204305
2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-hydroxypyrrolidine-1-carboxylic acid (PubChem CID 174204305) has the molecular formula C17H23BFNO5 and a molecular weight of 351.18 g/mol. Its IUPAC name is 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-hydroxypyrrolidine-1-carboxylic acid.
| Compound Name | 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-hydroxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174204305 |
| Molecular Formula | C17H23BFNO5 |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-hydroxypyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(C3CC(O)CN3C(=O)O)cc2F)OC1(C)C |
| InChI | InChI=1S/C17H23BFNO5/c1-16(2)17(3,4)25-18(24-16)12-6-5-10(7-13(12)19)14-8-11(21)9-20(14)15(22)23/h5-7,11,14,21H,8-9H2,1-4H3,(H,22,23) |
| InChIKey | OWNMTQDWTQSXOT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|