About 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide
2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide (PubChem CID 174204817) has the molecular formula C11H16BrNO3
and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide.
Molecular Properties
| Compound Name | 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide |
| PubChem CID | 174204817 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide |
| SMILES | Br.C=CN(Cc1ccccc1)C(O)C(O)O |
| InChI | InChI=1S/C11H15NO3.BrH/c1-2-12(10(13)11(14)15)8-9-6-4-3-5-7-9;/h2-7,10-11,13-15H,1,8H2;1H |
| InChIKey | WQGCUCHXFFQYTD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide?
The IUPAC name of 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide (CID 174204817) is 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide.
What is the SMILES notation for 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide?
The canonical SMILES for 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide is Br.C=CN(Cc1ccccc1)C(O)C(O)O.
What is the InChIKey of 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide?
The InChIKey is WQGCUCHXFFQYTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3.BrH/c1-2-12(10(13)11(14)15)8-9-6-4-3-5-7-9;/h2-7,10-11,13-15H,1,8H2;1H.
What are the key properties of 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide?
2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide has a molecular weight of 290.16 g/mol, XLogP of 0.84, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide is sourced from PubChem (CID 174204817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).