C11H16BrNO3 — CID 174204817
2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide (PubChem CID 174204817) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide.
| Compound Name | 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide |
|---|---|
| PubChem CID | 174204817 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[benzyl(ethenyl)amino]ethane-1,1,2-triol;hydrobromide |
| SMILES | Br.C=CN(Cc1ccccc1)C(O)C(O)O |
| InChI | InChI=1S/C11H15NO3.BrH/c1-2-12(10(13)11(14)15)8-9-6-4-3-5-7-9;/h2-7,10-11,13-15H,1,8H2;1H |
| InChIKey | WQGCUCHXFFQYTD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|