6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid

C9H7F2N3O3 — CID 174207229

IUPAC6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid
SMILESO=C(O)c1cc2n[nH]nc2cc1OCC(F)F
InChIInChI=1S/C9H7F2N3O3/c10-8(11)3-17-7-2-6-5(12-14-13-6)1-4(7)9(15)16/h1-2,8H,3H2,(H,15,16)(H,12,13,14)
InChIKeyKAUUSWIZAQHEMN-UHFFFAOYSA-N
MW243.17 g/mol
LogP1.30
Rot. Bonds4

About 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid

6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid (PubChem CID 174207229) has the molecular formula C9H7F2N3O3 and a molecular weight of 243.17 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid.

Molecular Properties

Compound Name6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid
PubChem CID174207229
Molecular FormulaC9H7F2N3O3
Molecular Weight243.17 g/mol
Exact Mass243.05
IUPAC Name6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid
SMILESO=C(O)c1cc2n[nH]nc2cc1OCC(F)F
InChIInChI=1S/C9H7F2N3O3/c10-8(11)3-17-7-2-6-5(12-14-13-6)1-4(7)9(15)16/h1-2,8H,3H2,(H,15,16)(H,12,13,14)
InChIKeyKAUUSWIZAQHEMN-UHFFFAOYSA-N
XLogP1.30
TPSA88.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.17
LogP ≤ 51.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid?
The IUPAC name of 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid (CID 174207229) is 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid.
What is the SMILES notation for 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid?
The canonical SMILES for 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid is O=C(O)c1cc2n[nH]nc2cc1OCC(F)F.
What is the InChIKey of 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid?
The InChIKey is KAUUSWIZAQHEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2N3O3/c10-8(11)3-17-7-2-6-5(12-14-13-6)1-4(7)9(15)16/h1-2,8H,3H2,(H,15,16)(H,12,13,14).
What are the key properties of 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid?
6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid has a molecular weight of 243.17 g/mol, XLogP of 1.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoroethoxy)-2H-benzotriazole-5-carboxylic acid is sourced from PubChem (CID 174207229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).