C12H16BrClN2O2S — CID 174207247
8-bromo-3-tert-butyl-7-chloro-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide (PubChem CID 174207247) has the molecular formula C12H16BrClN2O2S and a molecular weight of 367.70 g/mol. Its IUPAC name is 8-bromo-3-tert-butyl-7-chloro-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide.
| Compound Name | 8-bromo-3-tert-butyl-7-chloro-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 174207247 |
| Molecular Formula | C12H16BrClN2O2S |
| Molecular Weight | 367.70 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 8-bromo-3-tert-butyl-7-chloro-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide |
| SMILES | CC(C)(C)C1CNc2cc(Cl)c(Br)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C12H16BrClN2O2S/c1-12(2,3)11-6-15-9-5-8(14)7(13)4-10(9)19(17,18)16-11/h4-5,11,15-16H,6H2,1-3H3 |
| InChIKey | BSMHQSGMUXWKOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |