C34H37F3N9O2P — CID 174207248
2-N-[5-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-(2,2,2-trifluoroethoxy)phenyl]-4-N-(4-phosphorosoquinolin-3-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 174207248) has the molecular formula C34H37F3N9O2P and a molecular weight of 691.70 g/mol. Its IUPAC name is 2-N-[5-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-(2,2,2-trifluoroethoxy)phenyl]-4-N-(4-phosphorosoquinolin-3-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[5-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-(2,2,2-trifluoroethoxy)phenyl]-4-N-(4-phosphorosoquinolin-3-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174207248 |
| Molecular Formula | C34H37F3N9O2P |
| Molecular Weight | 691.70 g/mol |
| Exact Mass | 691.28 |
| IUPAC Name | 2-N-[5-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-(2,2,2-trifluoroethoxy)phenyl]-4-N-(4-phosphorosoquinolin-3-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2nc(Nc3cnc4ccccc4c3P=O)c3cc[nH]c3n2)c(OCC(F)(F)F)cc1N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C34H37F3N9O2P/c1-21-17-26(29(48-20-34(35,36)37)18-28(21)46-11-8-22(9-12-46)45-15-13-44(2)14-16-45)41-33-42-31-24(7-10-38-31)32(43-33)40-27-19-39-25-6-4-3-5-23(25)30(27)49-47/h3-7,10,17-19,22H,8-9,11-16,20H2,1-2H3,(H3,38,40,41,42,43) |
| InChIKey | CAYWVAOIJNIKFD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|