C24H28N4O2 — CID 17420754
N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-(1-phenylpyrazol-4-yl)propanamide (PubChem CID 17420754) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-(1-phenylpyrazol-4-yl)propanamide.
| Compound Name | N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-(1-phenylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 17420754 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-(1-phenylpyrazol-4-yl)propanamide |
| SMILES | O=C(CCc1cnn(-c2ccccc2)c1)NCc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C24H28N4O2/c29-24(11-10-20-16-26-28(18-20)23-8-2-1-3-9-23)25-17-21-6-4-5-7-22(21)19-27-12-14-30-15-13-27/h1-9,16,18H,10-15,17,19H2,(H,25,29) |
| InChIKey | FDGGVPGIPYGOAP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |