C30H29ClF3N5O5 — CID 174207929
[3-[[4-[5-chloro-3-methyl-2-(7-oxa-4-azaspiro[2.5]octan-6-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate (PubChem CID 174207929) has the molecular formula C30H29ClF3N5O5 and a molecular weight of 632.04 g/mol. Its IUPAC name is [3-[[4-[5-chloro-3-methyl-2-(7-oxa-4-azaspiro[2.5]octan-6-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[4-[5-chloro-3-methyl-2-(7-oxa-4-azaspiro[2.5]octan-6-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174207929 |
| Molecular Formula | C30H29ClF3N5O5 |
| Molecular Weight | 632.04 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | [3-[[4-[5-chloro-3-methyl-2-(7-oxa-4-azaspiro[2.5]octan-6-ylmethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C)(C)C5(OC(=O)C(F)(F)F)C4=O)cc23)c1CC1CNC2(CC2)CO1 |
| InChI | InChI=1S/C30H29ClF3N5O5/c1-15-6-17(31)8-20(19(15)9-18-10-36-28(4-5-28)13-43-18)22-21-7-16(12-39(21)37-14-35-22)11-38-24(40)23-27(2,3)29(23,25(38)41)44-26(42)30(32,33)34/h6-8,12,14,18,23,36H,4-5,9-11,13H2,1-3H3 |
| InChIKey | DVZWLQYRXSKHBH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.04 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|