C17H26BrN3O3S — CID 174209168
ethyl 2-[4-(6-bromohexanoylamino)piperidin-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 174209168) has the molecular formula C17H26BrN3O3S and a molecular weight of 432.38 g/mol. Its IUPAC name is ethyl 2-[4-(6-bromohexanoylamino)piperidin-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[4-(6-bromohexanoylamino)piperidin-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 174209168 |
| Molecular Formula | C17H26BrN3O3S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | ethyl 2-[4-(6-bromohexanoylamino)piperidin-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N2CCC(NC(=O)CCCCCBr)CC2)n1 |
| InChI | InChI=1S/C17H26BrN3O3S/c1-2-24-16(23)14-12-25-17(20-14)21-10-7-13(8-11-21)19-15(22)6-4-3-5-9-18/h12-13H,2-11H2,1H3,(H,19,22) |
| InChIKey | JZHWBPMLRNPBCH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|