About tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate
tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate (PubChem CID 174209702) has the molecular formula C21H40F2N4O4
and a molecular weight of 450.57 g/mol. Its IUPAC name is tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
| PubChem CID | 174209702 |
| Molecular Formula | C21H40F2N4O4 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CC(F)(F)CN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22F2N2O2.C9H18N2O2/c1-11(2,3)18-10(17)16-7-5-15(6-8-16)9-12(4,13)14;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h5-9H2,1-4H3;10H,4-7H2,1-3H3 |
| InChIKey | KIOCKRFIQGJLJV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate (CID 174209702) is tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCNCC1.CC(F)(F)CN1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The InChIKey is KIOCKRFIQGJLJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2O2.C9H18N2O2/c1-11(2,3)18-10(17)16-7-5-15(6-8-16)9-12(4,13)14;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h5-9H2,1-4H3;10H,4-7H2,1-3H3.
What are the key properties of tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate has a molecular weight of 450.57 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2,2-difluoropropyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate is sourced from PubChem (CID 174209702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).