About tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate
tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate (PubChem CID 174209758) has the molecular formula C24H48N4O5
and a molecular weight of 472.67 g/mol. Its IUPAC name is tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
| PubChem CID | 174209758 |
| Molecular Formula | C24H48N4O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CCC(O)(CC)CN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O3.C9H18N2O2/c1-6-15(19,7-2)12-16-8-10-17(11-9-16)13(18)20-14(3,4)5;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h19H,6-12H2,1-5H3;10H,4-7H2,1-3H3 |
| InChIKey | VYJOQQNSLPTDLN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate (CID 174209758) is tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCNCC1.CCC(O)(CC)CN1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
The InChIKey is VYJOQQNSLPTDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O3.C9H18N2O2/c1-6-15(19,7-2)12-16-8-10-17(11-9-16)13(18)20-14(3,4)5;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h19H,6-12H2,1-5H3;10H,4-7H2,1-3H3.
What are the key properties of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate?
tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate has a molecular weight of 472.67 g/mol, XLogP of 2.92, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate is sourced from PubChem (CID 174209758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).