C28H28F3NO4 — CID 174210111
3-[2-[2-(4-tert-butylphenyl)propan-2-yl]-N-formyl-4-(trifluoromethoxy)anilino]benzoic acid (PubChem CID 174210111) has the molecular formula C28H28F3NO4 and a molecular weight of 499.53 g/mol. Its IUPAC name is 3-[2-[2-(4-tert-butylphenyl)propan-2-yl]-N-formyl-4-(trifluoromethoxy)anilino]benzoic acid.
| Compound Name | 3-[2-[2-(4-tert-butylphenyl)propan-2-yl]-N-formyl-4-(trifluoromethoxy)anilino]benzoic acid |
|---|---|
| PubChem CID | 174210111 |
| Molecular Formula | C28H28F3NO4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 3-[2-[2-(4-tert-butylphenyl)propan-2-yl]-N-formyl-4-(trifluoromethoxy)anilino]benzoic acid |
| SMILES | CC(C)(C)c1ccc(C(C)(C)c2cc(OC(F)(F)F)ccc2N(C=O)c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C28H28F3NO4/c1-26(2,3)19-9-11-20(12-10-19)27(4,5)23-16-22(36-28(29,30)31)13-14-24(23)32(17-33)21-8-6-7-18(15-21)25(34)35/h6-17H,1-5H3,(H,34,35) |
| InChIKey | MWJQUCGTUXLALG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|