C28H27ClF5N5O5 — CID 174210437
3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 174210437) has the molecular formula C28H27ClF5N5O5 and a molecular weight of 644.00 g/mol. Its IUPAC name is 3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174210437 |
| Molecular Formula | C28H27ClF5N5O5 |
| Molecular Weight | 644.00 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | 3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1OC1CNCC(F)(F)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H26ClF2N5O3.C2HF3O2/c1-13-4-15(27)6-17(22(13)37-16-7-26(28,29)11-30-8-16)21-18-5-14(10-34(18)32-12-31-21)9-33-23(35)19-20(24(33)36)25(19,2)3;3-2(4,5)1(6)7/h4-6,10,12,16,19-20,30H,7-9,11H2,1-3H3;(H,6,7) |
| InChIKey | BHXJUIMFXJBRDN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.00 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|