C33H36FN3O3 — CID 174210574
N-[3-(5-fluoro-2-pyridinyl)-3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propyl]-2-hydroxybenzamide (PubChem CID 174210574) has the molecular formula C33H36FN3O3 and a molecular weight of 541.67 g/mol. Its IUPAC name is N-[3-(5-fluoro-2-pyridinyl)-3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propyl]-2-hydroxybenzamide.
| Compound Name | N-[3-(5-fluoro-2-pyridinyl)-3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 174210574 |
| Molecular Formula | C33H36FN3O3 |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | N-[3-(5-fluoro-2-pyridinyl)-3-[(13S,15R,17E)-17-hydroxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propyl]-2-hydroxybenzamide |
| SMILES | C[C@]12CCC3c4ccccc4CCC3C1C(C(CCNC(=O)c1ccccc1O)c1ccc(F)cn1)C/C2=N\O |
| InChI | InChI=1S/C33H36FN3O3/c1-33-16-14-23-22-7-3-2-6-20(22)10-12-25(23)31(33)27(18-30(33)37-40)24(28-13-11-21(34)19-36-28)15-17-35-32(39)26-8-4-5-9-29(26)38/h2-9,11,13,19,23-25,27,31,38,40H,10,12,14-18H2,1H3,(H,35,39)/b37-30+/t23?,24?,25?,27?,31?,33-/m1/s1 |
| InChIKey | IUMZTYLEOLZOMI-DSVFOVIBSA-N |
| XLogP | 6.44 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|