C26H31N5S — CID 174210995
5-[2-(2,6-diazaspiro[3.4]octan-6-yl)-4-(2,3-dimethylphenyl)-5,6,7,8-tetrahydroquinazolin-7-yl]-4-methyl-1,3-thiazole (PubChem CID 174210995) has the molecular formula C26H31N5S and a molecular weight of 445.64 g/mol. Its IUPAC name is 5-[2-(2,6-diazaspiro[3.4]octan-6-yl)-4-(2,3-dimethylphenyl)-5,6,7,8-tetrahydroquinazolin-7-yl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[2-(2,6-diazaspiro[3.4]octan-6-yl)-4-(2,3-dimethylphenyl)-5,6,7,8-tetrahydroquinazolin-7-yl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 174210995 |
| Molecular Formula | C26H31N5S |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 5-[2-(2,6-diazaspiro[3.4]octan-6-yl)-4-(2,3-dimethylphenyl)-5,6,7,8-tetrahydroquinazolin-7-yl]-4-methyl-1,3-thiazole |
| SMILES | Cc1cccc(-c2nc(N3CCC4(CNC4)C3)nc3c2CCC(c2scnc2C)C3)c1C |
| InChI | InChI=1S/C26H31N5S/c1-16-5-4-6-20(17(16)2)23-21-8-7-19(24-18(3)28-15-32-24)11-22(21)29-25(30-23)31-10-9-26(14-31)12-27-13-26/h4-6,15,19,27H,7-14H2,1-3H3 |
| InChIKey | ZSOMTMCIPIYBFM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |