C19H34F3N — CID 174211712
3-methyl-1,1-bis(prop-2-enyl)cyclobutane;8,8,8-trifluorooctan-1-amine (PubChem CID 174211712) has the molecular formula C19H34F3N and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-methyl-1,1-bis(prop-2-enyl)cyclobutane;8,8,8-trifluorooctan-1-amine.
| Compound Name | 3-methyl-1,1-bis(prop-2-enyl)cyclobutane;8,8,8-trifluorooctan-1-amine |
|---|---|
| PubChem CID | 174211712 |
| Molecular Formula | C19H34F3N |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 3-methyl-1,1-bis(prop-2-enyl)cyclobutane;8,8,8-trifluorooctan-1-amine |
| SMILES | C=CCC1(CC=C)CC(C)C1.NCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H18.C8H16F3N/c1-4-6-11(7-5-2)8-10(3)9-11;9-8(10,11)6-4-2-1-3-5-7-12/h4-5,10H,1-2,6-9H2,3H3;1-7,12H2 |
| InChIKey | GNDXEGVNAQWENN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|