C22H18N2O5 — CID 17421173
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 17421173) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 17421173 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4-dihydroxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2ccc(O)c(O)c2)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H18N2O5/c25-17-7-5-13(11-18(17)26)21-23-16-4-2-1-3-15(16)22(27)24(21)14-6-8-19-20(12-14)29-10-9-28-19/h1-8,11-12,21,23,25-26H,9-10H2 |
| InChIKey | VIBWJIAJJNPCLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|