About tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol
tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol (PubChem CID 174211837) has the molecular formula C25H52N4O4
and a molecular weight of 472.72 g/mol. Its IUPAC name is tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol.
Molecular Properties
| Compound Name | tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol |
| PubChem CID | 174211837 |
| Molecular Formula | C25H52N4O4 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol |
| SMILES | CCC(O)(CC)CN1CCN(C(=O)OC(C)(C)C)CC1.CCC(O)(CC)CN1CCNCC1 |
| InChI | InChI=1S/C15H30N2O3.C10H22N2O/c1-6-15(19,7-2)12-16-8-10-17(11-9-16)13(18)20-14(3,4)5;1-3-10(13,4-2)9-12-7-5-11-6-8-12/h19H,6-12H2,1-5H3;11,13H,3-9H2,1-2H3 |
| InChIKey | DPUWLBSSPZQNBR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol?
The IUPAC name of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol (CID 174211837) is tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol.
What is the SMILES notation for tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol?
The canonical SMILES for tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol is CCC(O)(CC)CN1CCN(C(=O)OC(C)(C)C)CC1.CCC(O)(CC)CN1CCNCC1.
What is the InChIKey of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol?
The InChIKey is DPUWLBSSPZQNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O3.C10H22N2O/c1-6-15(19,7-2)12-16-8-10-17(11-9-16)13(18)20-14(3,4)5;1-3-10(13,4-2)9-12-7-5-11-6-8-12/h19H,6-12H2,1-5H3;11,13H,3-9H2,1-2H3.
What are the key properties of tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol?
tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol has a molecular weight of 472.72 g/mol, XLogP of 2.53, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2-ethyl-2-hydroxybutyl)piperazine-1-carboxylate;3-(piperazin-1-ylmethyl)pentan-3-ol is sourced from PubChem (CID 174211837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).