C27H26ClF2N5O5 — CID 174212204
(5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylic acid (PubChem CID 174212204) has the molecular formula C27H26ClF2N5O5 and a molecular weight of 573.98 g/mol. Its IUPAC name is (5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylic acid.
| Compound Name | (5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174212204 |
| Molecular Formula | C27H26ClF2N5O5 |
| Molecular Weight | 573.98 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | (5S)-5-[4-chloro-2-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-6-methylphenoxy]-3,3-difluoropiperidine-1-carboxylic acid |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1O[C@@H]1CN(C(=O)O)CC(F)(F)C1 |
| InChI | InChI=1S/C27H26ClF2N5O5/c1-13-4-15(28)6-17(22(13)40-16-7-27(29,30)11-33(10-16)25(38)39)21-18-5-14(9-35(18)32-12-31-21)8-34-23(36)19-20(24(34)37)26(19,2)3/h4-6,9,12,16,19-20H,7-8,10-11H2,1-3H3,(H,38,39)/t16-,19?,20?/m0/s1 |
| InChIKey | AKGFHNPLXHHPID-DZIBYMRMSA-N |
| XLogP | 4.27 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.98 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|