C20H31N3 — CID 174213483
(9Z)-7-(2-cyclohexylethyl)-1,2-dimethyl-5-methylidene-2,3,4,6-tetrahydropyrido[3,2-e][1,3]diazocine (PubChem CID 174213483) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is (9Z)-7-(2-cyclohexylethyl)-1,2-dimethyl-5-methylidene-2,3,4,6-tetrahydropyrido[3,2-e][1,3]diazocine.
| Compound Name | (9Z)-7-(2-cyclohexylethyl)-1,2-dimethyl-5-methylidene-2,3,4,6-tetrahydropyrido[3,2-e][1,3]diazocine |
|---|---|
| PubChem CID | 174213483 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (9Z)-7-(2-cyclohexylethyl)-1,2-dimethyl-5-methylidene-2,3,4,6-tetrahydropyrido[3,2-e][1,3]diazocine |
| SMILES | C=C1N/C(CCC2CCCCC2)=N\C=C/C2=C1CCC(C)N2C |
| InChI | InChI=1S/C20H31N3/c1-15-9-11-18-16(2)22-20(21-14-13-19(18)23(15)3)12-10-17-7-5-4-6-8-17/h13-15,17H,2,4-12H2,1,3H3,(H,21,22)/b14-13- |
| InChIKey | YFLWNHSFHBFFQO-YPKPFQOOSA-N |
| XLogP | 4.74 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |