About (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid
(6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid (PubChem CID 174214352) has the molecular formula C12H13BrN2O3
and a molecular weight of 313.15 g/mol. Its IUPAC name is (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid.
Molecular Properties
| Compound Name | (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid |
| PubChem CID | 174214352 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid |
| SMILES | CN(CC1Cc2cc(Br)ccc2C(=O)N1)C(=O)O |
| InChI | InChI=1S/C12H13BrN2O3/c1-15(12(17)18)6-9-5-7-4-8(13)2-3-10(7)11(16)14-9/h2-4,9H,5-6H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | HGMCCDALHXHSPI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid?
The IUPAC name of (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid (CID 174214352) is (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid.
What is the SMILES notation for (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid?
The canonical SMILES for (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid is CN(CC1Cc2cc(Br)ccc2C(=O)N1)C(=O)O.
What is the InChIKey of (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid?
The InChIKey is HGMCCDALHXHSPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O3/c1-15(12(17)18)6-9-5-7-4-8(13)2-3-10(7)11(16)14-9/h2-4,9H,5-6H2,1H3,(H,14,16)(H,17,18).
What are the key properties of (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid?
(6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid has a molecular weight of 313.15 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl-methylcarbamic acid is sourced from PubChem (CID 174214352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).