About hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate
hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate (PubChem CID 174214716) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate.
Molecular Properties
| Compound Name | hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate |
| PubChem CID | 174214716 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate |
| SMILES | CC=CC(=O)OC(C(=O)OCCCCCC)C(C)CC(C)C |
| InChI | InChI=1S/C18H32O4/c1-6-8-9-10-12-21-18(20)17(15(5)13-14(3)4)22-16(19)11-7-2/h7,11,14-15,17H,6,8-10,12-13H2,1-5H3 |
| InChIKey | PASGSIXAWAYTQS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate?
The IUPAC name of hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate (CID 174214716) is hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate.
What is the SMILES notation for hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate?
The canonical SMILES for hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate is CC=CC(=O)OC(C(=O)OCCCCCC)C(C)CC(C)C.
What is the InChIKey of hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate?
The InChIKey is PASGSIXAWAYTQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O4/c1-6-8-9-10-12-21-18(20)17(15(5)13-14(3)4)22-16(19)11-7-2/h7,11,14-15,17H,6,8-10,12-13H2,1-5H3.
What are the key properties of hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate?
hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate has a molecular weight of 312.45 g/mol, XLogP of 4.28, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2-but-2-enoyloxy-3,5-dimethylhexanoate is sourced from PubChem (CID 174214716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).