About methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate
methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate (PubChem CID 174215060) has the molecular formula C13H12N4O4
and a molecular weight of 288.26 g/mol. Its IUPAC name is methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate |
| PubChem CID | 174215060 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate |
| SMILES | C#CC(=O)OC.COC(=O)c1cn(-c2ccccn2)nn1 |
| InChI | InChI=1S/C9H8N4O2.C4H4O2/c1-15-9(14)7-6-13(12-11-7)8-4-2-3-5-10-8;1-3-4(5)6-2/h2-6H,1H3;1H,2H3 |
| InChIKey | UVRVSUOPOQBGGU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate?
The IUPAC name of methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate (CID 174215060) is methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate.
What is the SMILES notation for methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate?
The canonical SMILES for methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate is C#CC(=O)OC.COC(=O)c1cn(-c2ccccn2)nn1.
What is the InChIKey of methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate?
The InChIKey is UVRVSUOPOQBGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2.C4H4O2/c1-15-9(14)7-6-13(12-11-7)8-4-2-3-5-10-8;1-3-4(5)6-2/h2-6H,1H3;1H,2H3.
What are the key properties of methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate?
methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate has a molecular weight of 288.26 g/mol, XLogP of 0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-ynoate;methyl 1-pyridin-2-yltriazole-4-carboxylate is sourced from PubChem (CID 174215060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).